C32H33F7N6O6 — CID 117077662
N-[4-(4-fluorophenyl)-3-[2-(4-morpholin-4-ylanilino)-4-pyridinyl]-1,2-oxazol-5-yl]-N',N'-dimethylethane-1,2-diamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 117077662) has the molecular formula C32H33F7N6O6 and a molecular weight of 730.64 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)-3-[2-(4-morpholin-4-ylanilino)-4-pyridinyl]-1,2-oxazol-5-yl]-N',N'-dimethylethane-1,2-diamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[4-(4-fluorophenyl)-3-[2-(4-morpholin-4-ylanilino)-4-pyridinyl]-1,2-oxazol-5-yl]-N',N'-dimethylethane-1,2-diamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 117077662 |
| Molecular Formula | C32H33F7N6O6 |
| Molecular Weight | 730.64 g/mol |
| Exact Mass | 730.23 |
| IUPAC Name | N-[4-(4-fluorophenyl)-3-[2-(4-morpholin-4-ylanilino)-4-pyridinyl]-1,2-oxazol-5-yl]-N',N'-dimethylethane-1,2-diamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)CCNc1onc(-c2ccnc(Nc3ccc(N4CCOCC4)cc3)c2)c1-c1ccc(F)cc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H31FN6O2.2C2HF3O2/c1-34(2)14-13-31-28-26(20-3-5-22(29)6-4-20)27(33-37-28)21-11-12-30-25(19-21)32-23-7-9-24(10-8-23)35-15-17-36-18-16-35;2*3-2(4,5)1(6)7/h3-12,19,31H,13-18H2,1-2H3,(H,30,32);2*(H,6,7) |
| InChIKey | FRLDBGAQMOFXRB-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 153.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.64 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|