C14H19N7 — CID 117079518
N-propyl-2-(1,3,5-trimethylpyrazol-4-yl)-7H-purin-6-amine (PubChem CID 117079518) has the molecular formula C14H19N7 and a molecular weight of 285.35 g/mol. Its IUPAC name is N-propyl-2-(1,3,5-trimethylpyrazol-4-yl)-7H-purin-6-amine.
| Compound Name | N-propyl-2-(1,3,5-trimethylpyrazol-4-yl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 117079518 |
| Molecular Formula | C14H19N7 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | N-propyl-2-(1,3,5-trimethylpyrazol-4-yl)-7H-purin-6-amine |
| SMILES | CCCNc1nc(-c2c(C)nn(C)c2C)nc2nc[nH]c12 |
| InChI | InChI=1S/C14H19N7/c1-5-6-15-13-11-14(17-7-16-11)19-12(18-13)10-8(2)20-21(4)9(10)3/h7H,5-6H2,1-4H3,(H2,15,16,17,18,19) |
| InChIKey | WUYGDQVUMKDHGX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |