About N-propyl-2-(1,3,5-trimethylpyrazol-4-yl)-7H-purin-6-amine
N-propyl-2-(1,3,5-trimethylpyrazol-4-yl)-7H-purin-6-amine (PubChem CID 117079518) has the molecular formula C14H19N7
and a molecular weight of 285.35 g/mol. Its IUPAC name is N-propyl-2-(1,3,5-trimethylpyrazol-4-yl)-7H-purin-6-amine.
Molecular Properties
| Compound Name | N-propyl-2-(1,3,5-trimethylpyrazol-4-yl)-7H-purin-6-amine |
| PubChem CID | 117079518 |
| Molecular Formula | C14H19N7 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | N-propyl-2-(1,3,5-trimethylpyrazol-4-yl)-7H-purin-6-amine |
| SMILES | CCCNc1nc(-c2c(C)nn(C)c2C)nc2nc[nH]c12 |
| InChI | InChI=1S/C14H19N7/c1-5-6-15-13-11-14(17-7-16-11)19-12(18-13)10-8(2)20-21(4)9(10)3/h7H,5-6H2,1-4H3,(H2,15,16,17,18,19) |
| InChIKey | WUYGDQVUMKDHGX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-propyl-2-(1,3,5-trimethylpyrazol-4-yl)-7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propyl-2-(1,3,5-trimethylpyrazol-4-yl)-7H-purin-6-amine?
The IUPAC name of N-propyl-2-(1,3,5-trimethylpyrazol-4-yl)-7H-purin-6-amine (CID 117079518) is N-propyl-2-(1,3,5-trimethylpyrazol-4-yl)-7H-purin-6-amine.
What is the SMILES notation for N-propyl-2-(1,3,5-trimethylpyrazol-4-yl)-7H-purin-6-amine?
The canonical SMILES for N-propyl-2-(1,3,5-trimethylpyrazol-4-yl)-7H-purin-6-amine is CCCNc1nc(-c2c(C)nn(C)c2C)nc2nc[nH]c12.
What is the InChIKey of N-propyl-2-(1,3,5-trimethylpyrazol-4-yl)-7H-purin-6-amine?
The InChIKey is WUYGDQVUMKDHGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N7/c1-5-6-15-13-11-14(17-7-16-11)19-12(18-13)10-8(2)20-21(4)9(10)3/h7H,5-6H2,1-4H3,(H2,15,16,17,18,19).
What are the key properties of N-propyl-2-(1,3,5-trimethylpyrazol-4-yl)-7H-purin-6-amine?
N-propyl-2-(1,3,5-trimethylpyrazol-4-yl)-7H-purin-6-amine has a molecular weight of 285.35 g/mol, XLogP of 2.19, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-propyl-2-(1,3,5-trimethylpyrazol-4-yl)-7H-purin-6-amine is sourced from PubChem (CID 117079518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).