About 5-ethynyldeca-1,9-diene
5-ethynyldeca-1,9-diene (PubChem CID 11708112) has the molecular formula C12H18
and a molecular weight of 162.28 g/mol. Its IUPAC name is 5-ethynyldeca-1,9-diene.
Molecular Properties
| Compound Name | 5-ethynyldeca-1,9-diene |
| PubChem CID | 11708112 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 5-ethynyldeca-1,9-diene |
| SMILES | C#CC(CCC=C)CCCC=C |
| InChI | InChI=1S/C12H18/c1-4-7-9-11-12(6-3)10-8-5-2/h3-5,12H,1-2,7-11H2 |
| InChIKey | MAJFMDFOWIOSLW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethynyldeca-1,9-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethynyldeca-1,9-diene?
The IUPAC name of 5-ethynyldeca-1,9-diene (CID 11708112) is 5-ethynyldeca-1,9-diene.
What is the SMILES notation for 5-ethynyldeca-1,9-diene?
The canonical SMILES for 5-ethynyldeca-1,9-diene is C#CC(CCC=C)CCCC=C.
What is the InChIKey of 5-ethynyldeca-1,9-diene?
The InChIKey is MAJFMDFOWIOSLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18/c1-4-7-9-11-12(6-3)10-8-5-2/h3-5,12H,1-2,7-11H2.
What are the key properties of 5-ethynyldeca-1,9-diene?
5-ethynyldeca-1,9-diene has a molecular weight of 162.28 g/mol, XLogP of 3.56, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethynyldeca-1,9-diene is sourced from PubChem (CID 11708112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).