C16H26 — CID 139252759
3,4,5,7,8-pentamethyl-6-methylidenedec-1-en-9-yne (PubChem CID 139252759) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is 3,4,5,7,8-pentamethyl-6-methylidenedec-1-en-9-yne.
| Compound Name | 3,4,5,7,8-pentamethyl-6-methylidenedec-1-en-9-yne |
|---|---|
| PubChem CID | 139252759 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 3,4,5,7,8-pentamethyl-6-methylidenedec-1-en-9-yne |
| SMILES | C#CC(C)C(C)C(=C)C(C)C(C)C(C)C=C |
| InChI | InChI=1S/C16H26/c1-9-11(3)13(5)15(7)16(8)14(6)12(4)10-2/h1,10-14,16H,2,7H2,3-6,8H3 |
| InChIKey | GHDUBTGELAUAHU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|