C22H36 — CID 162400477
(10S,11S,14E)-10-ethynyl-7,11,16-trimethylheptadeca-1,6,14-triene (PubChem CID 162400477) has the molecular formula C22H36 and a molecular weight of 300.53 g/mol. Its IUPAC name is (10S,11S,14E)-10-ethynyl-7,11,16-trimethylheptadeca-1,6,14-triene.
| Compound Name | (10S,11S,14E)-10-ethynyl-7,11,16-trimethylheptadeca-1,6,14-triene |
|---|---|
| PubChem CID | 162400477 |
| Molecular Formula | C22H36 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | (10S,11S,14E)-10-ethynyl-7,11,16-trimethylheptadeca-1,6,14-triene |
| SMILES | C#C[C@@H](CCC(C)=CCCCC=C)[C@@H](C)CC/C=C/C(C)C |
| InChI | InChI=1S/C22H36/c1-7-9-10-11-15-20(5)17-18-22(8-2)21(6)16-13-12-14-19(3)4/h2,7,12,14-15,19,21-22H,1,9-11,13,16-18H2,3-6H3/b14-12+,20-15?/t21-,22-/m0/s1 |
| InChIKey | AEHRWDXQRRBWIB-INNHGTRYSA-N |
| XLogP | 6.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|