C19H17N5OS — CID 117083706
N-benzyl-2-[(1-methylbenzimidazol-2-yl)amino]-1,3-thiazole-4-carboxamide (PubChem CID 117083706) has the molecular formula C19H17N5OS and a molecular weight of 363.45 g/mol. Its IUPAC name is N-benzyl-2-[(1-methylbenzimidazol-2-yl)amino]-1,3-thiazole-4-carboxamide.
| Compound Name | N-benzyl-2-[(1-methylbenzimidazol-2-yl)amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 117083706 |
| Molecular Formula | C19H17N5OS |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-benzyl-2-[(1-methylbenzimidazol-2-yl)amino]-1,3-thiazole-4-carboxamide |
| SMILES | Cn1c(Nc2nc(C(=O)NCc3ccccc3)cs2)nc2ccccc21 |
| InChI | InChI=1S/C19H17N5OS/c1-24-16-10-6-5-9-14(16)21-18(24)23-19-22-15(12-26-19)17(25)20-11-13-7-3-2-4-8-13/h2-10,12H,11H2,1H3,(H,20,25)(H,21,22,23) |
| InChIKey | OXMUNHJQGKMCCK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |