C14H16O2S — CID 11708586
(3aS,7aR)-1-oxo-3a-phenyl-2,3,4,5,6,7a-hexahydro-1-benzothiophen-7-one (PubChem CID 11708586) has the molecular formula C14H16O2S and a molecular weight of 248.35 g/mol. Its IUPAC name is (3aS,7aR)-1-oxo-3a-phenyl-2,3,4,5,6,7a-hexahydro-1-benzothiophen-7-one.
| Compound Name | (3aS,7aR)-1-oxo-3a-phenyl-2,3,4,5,6,7a-hexahydro-1-benzothiophen-7-one |
|---|---|
| PubChem CID | 11708586 |
| Molecular Formula | C14H16O2S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | (3aS,7aR)-1-oxo-3a-phenyl-2,3,4,5,6,7a-hexahydro-1-benzothiophen-7-one |
| SMILES | O=C1CCC[C@@]2(c3ccccc3)CCS(=O)[C@@H]12 |
| InChI | InChI=1S/C14H16O2S/c15-12-7-4-8-14(9-10-17(16)13(12)14)11-5-2-1-3-6-11/h1-3,5-6,13H,4,7-10H2/t13-,14-,17?/m0/s1 |
| InChIKey | SMRANYDLZADTQH-CBVZESEGSA-N |
| XLogP | 2.20 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |