C9H10N6 — CID 117086808
6-methyl-2-N-pyrazin-2-ylpyrimidine-2,4-diamine (PubChem CID 117086808) has the molecular formula C9H10N6 and a molecular weight of 202.22 g/mol. Its IUPAC name is 6-methyl-2-N-pyrazin-2-ylpyrimidine-2,4-diamine.
| Compound Name | 6-methyl-2-N-pyrazin-2-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 117086808 |
| Molecular Formula | C9H10N6 |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 6-methyl-2-N-pyrazin-2-ylpyrimidine-2,4-diamine |
| SMILES | Cc1cc(N)nc(Nc2cnccn2)n1 |
| InChI | InChI=1S/C9H10N6/c1-6-4-7(10)14-9(13-6)15-8-5-11-2-3-12-8/h2-5H,1H3,(H3,10,12,13,14,15) |
| InChIKey | KSBBJSUSLGLXDS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |