C14H21N5O3 — CID 11709309
6-methylheptyl 3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxylate (PubChem CID 11709309) has the molecular formula C14H21N5O3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 6-methylheptyl 3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxylate.
| Compound Name | 6-methylheptyl 3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxylate |
|---|---|
| PubChem CID | 11709309 |
| Molecular Formula | C14H21N5O3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 6-methylheptyl 3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxylate |
| SMILES | CC(C)CCCCCOC(=O)c1ncn2c(=O)n(C)nnc12 |
| InChI | InChI=1S/C14H21N5O3/c1-10(2)7-5-4-6-8-22-13(20)11-12-16-17-18(3)14(21)19(12)9-15-11/h9-10H,4-8H2,1-3H3 |
| InChIKey | NMDALQLGBOVXSS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 91.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|