C14H14N4S — CID 117101634
4-(2,3-dihydroindol-1-yl)-1,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidine-2-thione (PubChem CID 117101634) has the molecular formula C14H14N4S and a molecular weight of 270.36 g/mol. Its IUPAC name is 4-(2,3-dihydroindol-1-yl)-1,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidine-2-thione.
| Compound Name | 4-(2,3-dihydroindol-1-yl)-1,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 117101634 |
| Molecular Formula | C14H14N4S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 4-(2,3-dihydroindol-1-yl)-1,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidine-2-thione |
| SMILES | S=c1nc(N2CCc3ccccc32)c2c([nH]1)CNC2 |
| InChI | InChI=1S/C14H14N4S/c19-14-16-11-8-15-7-10(11)13(17-14)18-6-5-9-3-1-2-4-12(9)18/h1-4,15H,5-8H2,(H,16,17,19) |
| InChIKey | NABVFWPRXJNQFT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|