C14H20F6N5OP — CID 11711435
[benzotriazol-1-yloxy(piperidin-1-yl)methylidene]-dimethylazanium hexafluorophosphate (PubChem CID 11711435) has the molecular formula C14H20F6N5OP and a molecular weight of 419.31 g/mol. Its IUPAC name is [benzotriazol-1-yloxy(piperidin-1-yl)methylidene]-dimethylazanium hexafluorophosphate.
| Compound Name | [benzotriazol-1-yloxy(piperidin-1-yl)methylidene]-dimethylazanium hexafluorophosphate |
|---|---|
| PubChem CID | 11711435 |
| Molecular Formula | C14H20F6N5OP |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | [benzotriazol-1-yloxy(piperidin-1-yl)methylidene]-dimethylazanium hexafluorophosphate |
| SMILES | C[N+](C)=C(On1nnc2ccccc21)N1CCCCC1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C14H20N5O.F6P/c1-17(2)14(18-10-6-3-7-11-18)20-19-13-9-5-4-8-12(13)15-16-19;1-7(2,3,4,5)6/h4-5,8-9H,3,6-7,10-11H2,1-2H3;/q+1;-1 |
| InChIKey | DBPBQCOKNKTUSS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 46.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|