C21H35O8P — CID 11711987
(2-hydroxy-2-oxo-1,3,2λ5-dioxaphospholan-4-yl)methyl (9Z,12Z,14E)-16-hydroperoxyoctadeca-9,12,14-trienoate (PubChem CID 11711987) has the molecular formula C21H35O8P and a molecular weight of 446.48 g/mol. Its IUPAC name is (2-hydroxy-2-oxo-1,3,2λ5-dioxaphospholan-4-yl)methyl (9Z,12Z,14E)-16-hydroperoxyoctadeca-9,12,14-trienoate.
| Compound Name | (2-hydroxy-2-oxo-1,3,2λ5-dioxaphospholan-4-yl)methyl (9Z,12Z,14E)-16-hydroperoxyoctadeca-9,12,14-trienoate |
|---|---|
| PubChem CID | 11711987 |
| Molecular Formula | C21H35O8P |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (2-hydroxy-2-oxo-1,3,2λ5-dioxaphospholan-4-yl)methyl (9Z,12Z,14E)-16-hydroperoxyoctadeca-9,12,14-trienoate |
| SMILES | CCC(/C=C/C=C\C/C=C\CCCCCCCC(=O)OCC1COP(=O)(O)O1)OO |
| InChI | InChI=1S/C21H35O8P/c1-2-19(28-23)15-13-11-9-7-5-3-4-6-8-10-12-14-16-21(22)26-17-20-18-27-30(24,25)29-20/h3,5,9,11,13,15,19-20,23H,2,4,6-8,10,12,14,16-18H2,1H3,(H,24,25)/b5-3-,11-9-,15-13+ |
| InChIKey | GJQABAQVDPJZLB-CGLYFWTESA-N |
| XLogP | 5.10 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|