C11H12ClNO2S — CID 117120188
2-(4-chloro-1,1-dioxo-1-benzothiophen-2-yl)propan-1-amine (PubChem CID 117120188) has the molecular formula C11H12ClNO2S and a molecular weight of 257.74 g/mol. Its IUPAC name is 2-(4-chloro-1,1-dioxo-1-benzothiophen-2-yl)propan-1-amine.
| Compound Name | 2-(4-chloro-1,1-dioxo-1-benzothiophen-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 117120188 |
| Molecular Formula | C11H12ClNO2S |
| Molecular Weight | 257.74 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 2-(4-chloro-1,1-dioxo-1-benzothiophen-2-yl)propan-1-amine |
| SMILES | CC(CN)C1=Cc2c(Cl)cccc2S1(=O)=O |
| InChI | InChI=1S/C11H12ClNO2S/c1-7(6-13)11-5-8-9(12)3-2-4-10(8)16(11,14)15/h2-5,7H,6,13H2,1H3 |
| InChIKey | AXTLTZQKJHCOTE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.74 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |