C23H41F6OP — CID 11712684
2-hexadecyl-4,6-dimethylpyrylium hexafluorophosphate (PubChem CID 11712684) has the molecular formula C23H41F6OP and a molecular weight of 478.54 g/mol. Its IUPAC name is 2-hexadecyl-4,6-dimethylpyrylium hexafluorophosphate.
| Compound Name | 2-hexadecyl-4,6-dimethylpyrylium hexafluorophosphate |
|---|---|
| PubChem CID | 11712684 |
| Molecular Formula | C23H41F6OP |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | 2-hexadecyl-4,6-dimethylpyrylium hexafluorophosphate |
| SMILES | CCCCCCCCCCCCCCCCc1cc(C)cc(C)[o+]1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C23H41O.F6P/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-20-21(2)19-22(3)24-23;1-7(2,3,4,5)6/h19-20H,4-18H2,1-3H3;/q+1;-1 |
| InChIKey | YGSQJHXPHWUUPA-UHFFFAOYSA-N |
| XLogP | 11.58 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|