C24H43F6OP — CID 11712915
2-heptadecyl-4,6-dimethylpyrylium hexafluorophosphate (PubChem CID 11712915) has the molecular formula C24H43F6OP and a molecular weight of 492.57 g/mol. Its IUPAC name is 2-heptadecyl-4,6-dimethylpyrylium hexafluorophosphate.
| Compound Name | 2-heptadecyl-4,6-dimethylpyrylium hexafluorophosphate |
|---|---|
| PubChem CID | 11712915 |
| Molecular Formula | C24H43F6OP |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | 2-heptadecyl-4,6-dimethylpyrylium hexafluorophosphate |
| SMILES | CCCCCCCCCCCCCCCCCc1cc(C)cc(C)[o+]1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C24H43O.F6P/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24-21-22(2)20-23(3)25-24;1-7(2,3,4,5)6/h20-21H,4-19H2,1-3H3;/q+1;-1 |
| InChIKey | FTHULXZZZHBIRF-UHFFFAOYSA-N |
| XLogP | 11.97 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|