C15H12N2O2 — CID 117130318
2-[(3-hydroxyphenyl)methyl]imidazo[1,2-a]pyridine-6-carbaldehyde (PubChem CID 117130318) has the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-[(3-hydroxyphenyl)methyl]imidazo[1,2-a]pyridine-6-carbaldehyde.
| Compound Name | 2-[(3-hydroxyphenyl)methyl]imidazo[1,2-a]pyridine-6-carbaldehyde |
|---|---|
| PubChem CID | 117130318 |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 2-[(3-hydroxyphenyl)methyl]imidazo[1,2-a]pyridine-6-carbaldehyde |
| SMILES | O=Cc1ccc2nc(Cc3cccc(O)c3)cn2c1 |
| InChI | InChI=1S/C15H12N2O2/c18-10-12-4-5-15-16-13(9-17(15)8-12)6-11-2-1-3-14(19)7-11/h1-5,7-10,19H,6H2 |
| InChIKey | YWEKOOORLDUGLR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|