C11H9N3O — CID 117132415
2-(furan-2-yl)imidazo[1,2-a]pyridin-5-amine (PubChem CID 117132415) has the molecular formula C11H9N3O and a molecular weight of 199.21 g/mol. Its IUPAC name is 2-(furan-2-yl)imidazo[1,2-a]pyridin-5-amine.
| Compound Name | 2-(furan-2-yl)imidazo[1,2-a]pyridin-5-amine |
|---|---|
| PubChem CID | 117132415 |
| Molecular Formula | C11H9N3O |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 2-(furan-2-yl)imidazo[1,2-a]pyridin-5-amine |
| SMILES | Nc1cccc2nc(-c3ccco3)cn12 |
| InChI | InChI=1S/C11H9N3O/c12-10-4-1-5-11-13-8(7-14(10)11)9-3-2-6-15-9/h1-7H,12H2 |
| InChIKey | QSNWDOYVLNLMIY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 56.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |