C11H12BrN3OS — CID 117155023
[2-(5-bromothiophen-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-yl]methanol (PubChem CID 117155023) has the molecular formula C11H12BrN3OS and a molecular weight of 314.21 g/mol. Its IUPAC name is [2-(5-bromothiophen-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-yl]methanol.
| Compound Name | [2-(5-bromothiophen-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-yl]methanol |
|---|---|
| PubChem CID | 117155023 |
| Molecular Formula | C11H12BrN3OS |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | [2-(5-bromothiophen-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-yl]methanol |
| SMILES | OCC1CCCc2nc(-c3ccc(Br)s3)nn21 |
| InChI | InChI=1S/C11H12BrN3OS/c12-9-5-4-8(17-9)11-13-10-3-1-2-7(6-16)15(10)14-11/h4-5,7,16H,1-3,6H2 |
| InChIKey | UKLVJAFUSJEOFI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |