C15H17FO3 — CID 11715903
4-(1,4-dioxaspiro[4.5]decan-8-yl)-2-fluorobenzaldehyde (PubChem CID 11715903) has the molecular formula C15H17FO3 and a molecular weight of 264.30 g/mol. Its IUPAC name is 4-(1,4-dioxaspiro[4.5]decan-8-yl)-2-fluorobenzaldehyde.
| Compound Name | 4-(1,4-dioxaspiro[4.5]decan-8-yl)-2-fluorobenzaldehyde |
|---|---|
| PubChem CID | 11715903 |
| Molecular Formula | C15H17FO3 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 4-(1,4-dioxaspiro[4.5]decan-8-yl)-2-fluorobenzaldehyde |
| SMILES | O=Cc1ccc(C2CCC3(CC2)OCCO3)cc1F |
| InChI | InChI=1S/C15H17FO3/c16-14-9-12(1-2-13(14)10-17)11-3-5-15(6-4-11)18-7-8-19-15/h1-2,9-11H,3-8H2 |
| InChIKey | IQUGMQQVQCGASX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|