C18H17N3O2 — CID 11716497
6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2,3-dihydrophthalazine-1,4-dione (PubChem CID 11716497) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is 6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2,3-dihydrophthalazine-1,4-dione.
| Compound Name | 6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2,3-dihydrophthalazine-1,4-dione |
|---|---|
| PubChem CID | 11716497 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2,3-dihydrophthalazine-1,4-dione |
| SMILES | CN(C)c1ccc(/C=C/c2ccc3c(=O)[nH][nH]c(=O)c3c2)cc1 |
| InChI | InChI=1S/C18H17N3O2/c1-21(2)14-8-5-12(6-9-14)3-4-13-7-10-15-16(11-13)18(23)20-19-17(15)22/h3-11H,1-2H3,(H,19,22)(H,20,23)/b4-3+ |
| InChIKey | UEVHIGWFXZBDJM-ONEGZZNKSA-N |
| XLogP | 2.45 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|