C18H29FO3 — CID 11716595
(1R,2R,3aS,3bR,5aR,7R,9aS,9bS,11aS)-2-fluoro-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,7,9,9b,10,11-tetradecahydroindeno[4,5-h]isochromene-1,7-diol (PubChem CID 11716595) has the molecular formula C18H29FO3 and a molecular weight of 312.43 g/mol. Its IUPAC name is (1R,2R,3aS,3bR,5aR,7R,9aS,9bS,11aS)-2-fluoro-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,7,9,9b,10,11-tetradecahydroindeno[4,5-h]isochromene-1,7-diol.
| Compound Name | (1R,2R,3aS,3bR,5aR,7R,9aS,9bS,11aS)-2-fluoro-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,7,9,9b,10,11-tetradecahydroindeno[4,5-h]isochromene-1,7-diol |
|---|---|
| PubChem CID | 11716595 |
| Molecular Formula | C18H29FO3 |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | (1R,2R,3aS,3bR,5aR,7R,9aS,9bS,11aS)-2-fluoro-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,7,9,9b,10,11-tetradecahydroindeno[4,5-h]isochromene-1,7-diol |
| SMILES | C[C@]12CO[C@@H](O)C[C@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)[C@H](F)C[C@@H]12 |
| InChI | InChI=1S/C18H29FO3/c1-17-6-5-12-11(13(17)8-14(19)16(17)21)4-3-10-7-15(20)22-9-18(10,12)2/h10-16,20-21H,3-9H2,1-2H3/t10-,11-,12+,13+,14-,15-,16+,17+,18+/m1/s1 |
| InChIKey | NVUGRKWOAPOQNT-SRUZXEAMSA-N |
| XLogP | 2.89 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |