C9H18N2O2 — CID 117168350
2-(2-pyrrolidin-3-yl-1,3-dioxolan-4-yl)ethanamine (PubChem CID 117168350) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-(2-pyrrolidin-3-yl-1,3-dioxolan-4-yl)ethanamine.
| Compound Name | 2-(2-pyrrolidin-3-yl-1,3-dioxolan-4-yl)ethanamine |
|---|---|
| PubChem CID | 117168350 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 2-(2-pyrrolidin-3-yl-1,3-dioxolan-4-yl)ethanamine |
| SMILES | NCCC1COC(C2CCNC2)O1 |
| InChI | InChI=1S/C9H18N2O2/c10-3-1-8-6-12-9(13-8)7-2-4-11-5-7/h7-9,11H,1-6,10H2 |
| InChIKey | SNQMWTFUGQVMIN-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |