C12H15FO3 — CID 117169456
2-[2-[(3-fluorophenyl)methyl]-1,3-dioxolan-4-yl]ethanol (PubChem CID 117169456) has the molecular formula C12H15FO3 and a molecular weight of 226.25 g/mol. Its IUPAC name is 2-[2-[(3-fluorophenyl)methyl]-1,3-dioxolan-4-yl]ethanol.
| Compound Name | 2-[2-[(3-fluorophenyl)methyl]-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 117169456 |
| Molecular Formula | C12H15FO3 |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-[2-[(3-fluorophenyl)methyl]-1,3-dioxolan-4-yl]ethanol |
| SMILES | OCCC1COC(Cc2cccc(F)c2)O1 |
| InChI | InChI=1S/C12H15FO3/c13-10-3-1-2-9(6-10)7-12-15-8-11(16-12)4-5-14/h1-3,6,11-12,14H,4-5,7-8H2 |
| InChIKey | RWKKXDPQQIXHKH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |