C19H42OSi2 — CID 11717129
trimethyl-[(4R)-4-methyl-2-methylidene-5-tri(propan-2-yl)silyloxypentyl]silane (PubChem CID 11717129) has the molecular formula C19H42OSi2 and a molecular weight of 342.72 g/mol. Its IUPAC name is trimethyl-[(4R)-4-methyl-2-methylidene-5-tri(propan-2-yl)silyloxypentyl]silane.
| Compound Name | trimethyl-[(4R)-4-methyl-2-methylidene-5-tri(propan-2-yl)silyloxypentyl]silane |
|---|---|
| PubChem CID | 11717129 |
| Molecular Formula | C19H42OSi2 |
| Molecular Weight | 342.72 g/mol |
| Exact Mass | 342.28 |
| IUPAC Name | trimethyl-[(4R)-4-methyl-2-methylidene-5-tri(propan-2-yl)silyloxypentyl]silane |
| SMILES | C=C(C[C@@H](C)CO[Si](C(C)C)(C(C)C)C(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C19H42OSi2/c1-15(2)22(16(3)4,17(5)6)20-13-18(7)12-19(8)14-21(9,10)11/h15-18H,8,12-14H2,1-7,9-11H3/t18-/m1/s1 |
| InChIKey | LQTLTVZXNBPAKX-GOSISDBHSA-N |
| XLogP | 7.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.72 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|