C12H15NO4S2 — CID 117177850
1,1-dioxo-3-(propan-2-ylsulfonylmethyl)-1-benzothiophen-6-amine (PubChem CID 117177850) has the molecular formula C12H15NO4S2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 1,1-dioxo-3-(propan-2-ylsulfonylmethyl)-1-benzothiophen-6-amine.
| Compound Name | 1,1-dioxo-3-(propan-2-ylsulfonylmethyl)-1-benzothiophen-6-amine |
|---|---|
| PubChem CID | 117177850 |
| Molecular Formula | C12H15NO4S2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 1,1-dioxo-3-(propan-2-ylsulfonylmethyl)-1-benzothiophen-6-amine |
| SMILES | CC(C)S(=O)(=O)CC1=CS(=O)(=O)c2cc(N)ccc21 |
| InChI | InChI=1S/C12H15NO4S2/c1-8(2)18(14,15)6-9-7-19(16,17)12-5-10(13)3-4-11(9)12/h3-5,7-8H,6,13H2,1-2H3 |
| InChIKey | GWLZEDJLQWDEFT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|