C16H11F5N2O3S — CID 11718391
2,3,4,5,6-pentafluoro-N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)benzamide (PubChem CID 11718391) has the molecular formula C16H11F5N2O3S and a molecular weight of 406.33 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)benzamide |
|---|---|
| PubChem CID | 11718391 |
| Molecular Formula | C16H11F5N2O3S |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)benzamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CC(NC(=O)c1c(F)c(F)c(F)c(F)c1F)C2 |
| InChI | InChI=1S/C16H11F5N2O3S/c17-11-10(12(18)14(20)15(21)13(11)19)16(24)23-8-3-6-1-2-9(27(22,25)26)5-7(6)4-8/h1-2,5,8H,3-4H2,(H,23,24)(H2,22,25,26) |
| InChIKey | DTWDCDSAKWSSGY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|