C12H15NO — CID 117185979
2-(methoxymethyl)-1,6-dimethylindole (PubChem CID 117185979) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-(methoxymethyl)-1,6-dimethylindole.
| Compound Name | 2-(methoxymethyl)-1,6-dimethylindole |
|---|---|
| PubChem CID | 117185979 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 2-(methoxymethyl)-1,6-dimethylindole |
| SMILES | COCc1cc2ccc(C)cc2n1C |
| InChI | InChI=1S/C12H15NO/c1-9-4-5-10-7-11(8-14-3)13(2)12(10)6-9/h4-7H,8H2,1-3H3 |
| InChIKey | AGHKEDOFQAGWCU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |