About N-[(1,1-dioxo-1,3-thiazol-2-yl)methyl]cyclobutanamine
N-[(1,1-dioxo-1,3-thiazol-2-yl)methyl]cyclobutanamine (PubChem CID 117186801) has the molecular formula C8H12N2O2S
and a molecular weight of 200.26 g/mol. Its IUPAC name is N-[(1,1-dioxo-1,3-thiazol-2-yl)methyl]cyclobutanamine.
Molecular Properties
| Compound Name | N-[(1,1-dioxo-1,3-thiazol-2-yl)methyl]cyclobutanamine |
| PubChem CID | 117186801 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | N-[(1,1-dioxo-1,3-thiazol-2-yl)methyl]cyclobutanamine |
| SMILES | O=S1(=O)C=CN=C1CNC1CCC1 |
| InChI | InChI=1S/C8H12N2O2S/c11-13(12)5-4-9-8(13)6-10-7-2-1-3-7/h4-5,7,10H,1-3,6H2 |
| InChIKey | WBMNKYGNNVOONL-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1,1-dioxo-1,3-thiazol-2-yl)methyl]cyclobutanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,1-dioxo-1,3-thiazol-2-yl)methyl]cyclobutanamine?
The IUPAC name of N-[(1,1-dioxo-1,3-thiazol-2-yl)methyl]cyclobutanamine (CID 117186801) is N-[(1,1-dioxo-1,3-thiazol-2-yl)methyl]cyclobutanamine.
What is the SMILES notation for N-[(1,1-dioxo-1,3-thiazol-2-yl)methyl]cyclobutanamine?
The canonical SMILES for N-[(1,1-dioxo-1,3-thiazol-2-yl)methyl]cyclobutanamine is O=S1(=O)C=CN=C1CNC1CCC1.
What is the InChIKey of N-[(1,1-dioxo-1,3-thiazol-2-yl)methyl]cyclobutanamine?
The InChIKey is WBMNKYGNNVOONL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S/c11-13(12)5-4-9-8(13)6-10-7-2-1-3-7/h4-5,7,10H,1-3,6H2.
What are the key properties of N-[(1,1-dioxo-1,3-thiazol-2-yl)methyl]cyclobutanamine?
N-[(1,1-dioxo-1,3-thiazol-2-yl)methyl]cyclobutanamine has a molecular weight of 200.26 g/mol, XLogP of 0.43, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,1-dioxo-1,3-thiazol-2-yl)methyl]cyclobutanamine is sourced from PubChem (CID 117186801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).