C13H19N — CID 117193770
2-ethyl-2,3,6-trimethyl-1,3-dihydroindole (PubChem CID 117193770) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 2-ethyl-2,3,6-trimethyl-1,3-dihydroindole.
| Compound Name | 2-ethyl-2,3,6-trimethyl-1,3-dihydroindole |
|---|---|
| PubChem CID | 117193770 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 2-ethyl-2,3,6-trimethyl-1,3-dihydroindole |
| SMILES | CCC1(C)Nc2cc(C)ccc2C1C |
| InChI | InChI=1S/C13H19N/c1-5-13(4)10(3)11-7-6-9(2)8-12(11)14-13/h6-8,10,14H,5H2,1-4H3 |
| InChIKey | UVXMGCDYNWGZOP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |