C22H19ClN4O3S — CID 11719453
4-chlorobutyl N-[3-[3-(thiophene-2-carbonyl)pyrazolo[1,5-a]pyrimidin-7-yl]phenyl]carbamate (PubChem CID 11719453) has the molecular formula C22H19ClN4O3S and a molecular weight of 454.94 g/mol. Its IUPAC name is 4-chlorobutyl N-[3-[3-(thiophene-2-carbonyl)pyrazolo[1,5-a]pyrimidin-7-yl]phenyl]carbamate.
| Compound Name | 4-chlorobutyl N-[3-[3-(thiophene-2-carbonyl)pyrazolo[1,5-a]pyrimidin-7-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 11719453 |
| Molecular Formula | C22H19ClN4O3S |
| Molecular Weight | 454.94 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 4-chlorobutyl N-[3-[3-(thiophene-2-carbonyl)pyrazolo[1,5-a]pyrimidin-7-yl]phenyl]carbamate |
| SMILES | O=C(Nc1cccc(-c2ccnc3c(C(=O)c4cccs4)cnn23)c1)OCCCCCl |
| InChI | InChI=1S/C22H19ClN4O3S/c23-9-1-2-11-30-22(29)26-16-6-3-5-15(13-16)18-8-10-24-21-17(14-25-27(18)21)20(28)19-7-4-12-31-19/h3-8,10,12-14H,1-2,9,11H2,(H,26,29) |
| InChIKey | HXBMEZSIQIDKSH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.94 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|