C20H16N4O2S2 — CID 86603955
O-ethyl N-[3-[3-(thiophene-2-carbonyl)pyrazolo[1,5-a]pyrimidin-7-yl]phenyl]carbamothioate (PubChem CID 86603955) has the molecular formula C20H16N4O2S2 and a molecular weight of 408.51 g/mol. Its IUPAC name is O-ethyl N-[3-[3-(thiophene-2-carbonyl)pyrazolo[1,5-a]pyrimidin-7-yl]phenyl]carbamothioate.
| Compound Name | O-ethyl N-[3-[3-(thiophene-2-carbonyl)pyrazolo[1,5-a]pyrimidin-7-yl]phenyl]carbamothioate |
|---|---|
| PubChem CID | 86603955 |
| Molecular Formula | C20H16N4O2S2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | O-ethyl N-[3-[3-(thiophene-2-carbonyl)pyrazolo[1,5-a]pyrimidin-7-yl]phenyl]carbamothioate |
| SMILES | CCOC(=S)Nc1cccc(-c2ccnc3c(C(=O)c4cccs4)cnn23)c1 |
| InChI | InChI=1S/C20H16N4O2S2/c1-2-26-20(27)23-14-6-3-5-13(11-14)16-8-9-21-19-15(12-22-24(16)19)18(25)17-7-4-10-28-17/h3-12H,2H2,1H3,(H,23,27) |
| InChIKey | MIBNPPGJLDXRNV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|