C17H11FN4OS — CID 76974101
[7-(3-amino-4-fluoro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)pyrazolo[1,5-a]pyrimidin-3-yl]-thiophen-2-ylmethanone (PubChem CID 76974101) has the molecular formula C17H11FN4OS and a molecular weight of 344.32 g/mol. Its IUPAC name is [7-(3-amino-4-fluoro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)pyrazolo[1,5-a]pyrimidin-3-yl]-thiophen-2-ylmethanone.
| Compound Name | [7-(3-amino-4-fluoro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)pyrazolo[1,5-a]pyrimidin-3-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 76974101 |
| Molecular Formula | C17H11FN4OS |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | [7-(3-amino-4-fluoro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)pyrazolo[1,5-a]pyrimidin-3-yl]-thiophen-2-ylmethanone |
| SMILES | N[13c]1[13cH][13c](-c2ccnc3c(C(=O)c4cccs4)cnn23)[13cH][13cH][13c]1F |
| InChI | InChI=1S/C17H11FN4OS/c18-12-4-3-10(8-13(12)19)14-5-6-20-17-11(9-21-22(14)17)16(23)15-2-1-7-24-15/h1-9H,19H2/i3+1,4+1,8+1,10+1,12+1,13+1 |
| InChIKey | RRGDWNXLASGNFJ-VLGZGZRSSA-N |
| XLogP | 3.41 |
| TPSA | 73.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|