C24H22F3N3O5 — CID 11720103
prop-2-enyl N-[4-methoxy-1-methyl-5-[[4-[4-(trifluoromethyl)phenoxy]phenyl]carbamoyl]pyrrol-3-yl]carbamate (PubChem CID 11720103) has the molecular formula C24H22F3N3O5 and a molecular weight of 489.45 g/mol. Its IUPAC name is prop-2-enyl N-[4-methoxy-1-methyl-5-[[4-[4-(trifluoromethyl)phenoxy]phenyl]carbamoyl]pyrrol-3-yl]carbamate.
| Compound Name | prop-2-enyl N-[4-methoxy-1-methyl-5-[[4-[4-(trifluoromethyl)phenoxy]phenyl]carbamoyl]pyrrol-3-yl]carbamate |
|---|---|
| PubChem CID | 11720103 |
| Molecular Formula | C24H22F3N3O5 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | prop-2-enyl N-[4-methoxy-1-methyl-5-[[4-[4-(trifluoromethyl)phenoxy]phenyl]carbamoyl]pyrrol-3-yl]carbamate |
| SMILES | C=CCOC(=O)Nc1cn(C)c(C(=O)Nc2ccc(Oc3ccc(C(F)(F)F)cc3)cc2)c1OC |
| InChI | InChI=1S/C24H22F3N3O5/c1-4-13-34-23(32)29-19-14-30(2)20(21(19)33-3)22(31)28-16-7-11-18(12-8-16)35-17-9-5-15(6-10-17)24(25,26)27/h4-12,14H,1,13H2,2-3H3,(H,28,31)(H,29,32) |
| InChIKey | JZAVEDIRAVFFOQ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|