C10H14N2 — CID 117203931
(2-methyl-2,3-dihydro-1H-indol-7-yl)methanamine (PubChem CID 117203931) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is (2-methyl-2,3-dihydro-1H-indol-7-yl)methanamine.
| Compound Name | (2-methyl-2,3-dihydro-1H-indol-7-yl)methanamine |
|---|---|
| PubChem CID | 117203931 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (2-methyl-2,3-dihydro-1H-indol-7-yl)methanamine |
| SMILES | CC1Cc2cccc(CN)c2N1 |
| InChI | InChI=1S/C10H14N2/c1-7-5-8-3-2-4-9(6-11)10(8)12-7/h2-4,7,12H,5-6,11H2,1H3 |
| InChIKey | NDCXMSCNAAAHFZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |