About 3-sulfanylcarbonyl-1,2-thiazole-5-carboxylic acid
3-sulfanylcarbonyl-1,2-thiazole-5-carboxylic acid (PubChem CID 117215251) has the molecular formula C5H3NO3S2
and a molecular weight of 189.22 g/mol. Its IUPAC name is 3-sulfanylcarbonyl-1,2-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-sulfanylcarbonyl-1,2-thiazole-5-carboxylic acid |
| PubChem CID | 117215251 |
| Molecular Formula | C5H3NO3S2 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 188.96 |
| IUPAC Name | 3-sulfanylcarbonyl-1,2-thiazole-5-carboxylic acid |
| SMILES | O=C(S)c1cc(C(=O)O)sn1 |
| InChI | InChI=1S/C5H3NO3S2/c7-4(8)3-1-2(5(9)10)6-11-3/h1H,(H,7,8)(H,9,10) |
| InChIKey | LMVHVWMXJIMPSG-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-sulfanylcarbonyl-1,2-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-sulfanylcarbonyl-1,2-thiazole-5-carboxylic acid?
The IUPAC name of 3-sulfanylcarbonyl-1,2-thiazole-5-carboxylic acid (CID 117215251) is 3-sulfanylcarbonyl-1,2-thiazole-5-carboxylic acid.
What is the SMILES notation for 3-sulfanylcarbonyl-1,2-thiazole-5-carboxylic acid?
The canonical SMILES for 3-sulfanylcarbonyl-1,2-thiazole-5-carboxylic acid is O=C(S)c1cc(C(=O)O)sn1.
What is the InChIKey of 3-sulfanylcarbonyl-1,2-thiazole-5-carboxylic acid?
The InChIKey is LMVHVWMXJIMPSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3NO3S2/c7-4(8)3-1-2(5(9)10)6-11-3/h1H,(H,7,8)(H,9,10).
What are the key properties of 3-sulfanylcarbonyl-1,2-thiazole-5-carboxylic acid?
3-sulfanylcarbonyl-1,2-thiazole-5-carboxylic acid has a molecular weight of 189.22 g/mol, XLogP of 0.91, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-sulfanylcarbonyl-1,2-thiazole-5-carboxylic acid is sourced from PubChem (CID 117215251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).