C12H9NO5S — CID 117218310
5-(4-methoxyphenoxy)carbonyl-1,2-thiazole-3-carboxylic acid (PubChem CID 117218310) has the molecular formula C12H9NO5S and a molecular weight of 279.27 g/mol. Its IUPAC name is 5-(4-methoxyphenoxy)carbonyl-1,2-thiazole-3-carboxylic acid.
| Compound Name | 5-(4-methoxyphenoxy)carbonyl-1,2-thiazole-3-carboxylic acid |
|---|---|
| PubChem CID | 117218310 |
| Molecular Formula | C12H9NO5S |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 5-(4-methoxyphenoxy)carbonyl-1,2-thiazole-3-carboxylic acid |
| SMILES | COc1ccc(OC(=O)c2cc(C(=O)O)ns2)cc1 |
| InChI | InChI=1S/C12H9NO5S/c1-17-7-2-4-8(5-3-7)18-12(16)10-6-9(11(14)15)13-19-10/h2-6H,1H3,(H,14,15) |
| InChIKey | BCRNIIDNUGANRW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|