C7H7NO3S2 — CID 117218325
5-ethylsulfanylcarbonyl-1,2-thiazole-3-carboxylic acid (PubChem CID 117218325) has the molecular formula C7H7NO3S2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 5-ethylsulfanylcarbonyl-1,2-thiazole-3-carboxylic acid.
| Compound Name | 5-ethylsulfanylcarbonyl-1,2-thiazole-3-carboxylic acid |
|---|---|
| PubChem CID | 117218325 |
| Molecular Formula | C7H7NO3S2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 216.99 |
| IUPAC Name | 5-ethylsulfanylcarbonyl-1,2-thiazole-3-carboxylic acid |
| SMILES | CCSC(=O)c1cc(C(=O)O)ns1 |
| InChI | InChI=1S/C7H7NO3S2/c1-2-12-7(11)5-3-4(6(9)10)8-13-5/h3H,2H2,1H3,(H,9,10) |
| InChIKey | RVEISRFMRPANHF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|