3-ethylsulfanylcarbonyl-1,2-oxazole-5-carboxylic acid

C7H7NO4S — CID 117215058

IUPAC3-ethylsulfanylcarbonyl-1,2-oxazole-5-carboxylic acid
SMILESCCSC(=O)c1cc(C(=O)O)on1
InChIInChI=1S/C7H7NO4S/c1-2-13-7(11)4-3-5(6(9)10)12-8-4/h3H,2H2,1H3,(H,9,10)
InChIKeyYNJNOXOMGAUPBD-UHFFFAOYSA-N
MW201.20 g/mol
LogP1.27
Rot. Bonds3

About 3-ethylsulfanylcarbonyl-1,2-oxazole-5-carboxylic acid

3-ethylsulfanylcarbonyl-1,2-oxazole-5-carboxylic acid (PubChem CID 117215058) has the molecular formula C7H7NO4S and a molecular weight of 201.20 g/mol. Its IUPAC name is 3-ethylsulfanylcarbonyl-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name3-ethylsulfanylcarbonyl-1,2-oxazole-5-carboxylic acid
PubChem CID117215058
Molecular FormulaC7H7NO4S
Molecular Weight201.20 g/mol
Exact Mass201.01
IUPAC Name3-ethylsulfanylcarbonyl-1,2-oxazole-5-carboxylic acid
SMILESCCSC(=O)c1cc(C(=O)O)on1
InChIInChI=1S/C7H7NO4S/c1-2-13-7(11)4-3-5(6(9)10)12-8-4/h3H,2H2,1H3,(H,9,10)
InChIKeyYNJNOXOMGAUPBD-UHFFFAOYSA-N
XLogP1.27
TPSA80.40 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.20
LogP ≤ 51.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thioester', 'substructure': 'N/A'}

Analyze 3-ethylsulfanylcarbonyl-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-ethylsulfanylcarbonyl-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-ethylsulfanylcarbonyl-1,2-oxazole-5-carboxylic acid (CID 117215058) is 3-ethylsulfanylcarbonyl-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-ethylsulfanylcarbonyl-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-ethylsulfanylcarbonyl-1,2-oxazole-5-carboxylic acid is CCSC(=O)c1cc(C(=O)O)on1.
What is the InChIKey of 3-ethylsulfanylcarbonyl-1,2-oxazole-5-carboxylic acid?
The InChIKey is YNJNOXOMGAUPBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO4S/c1-2-13-7(11)4-3-5(6(9)10)12-8-4/h3H,2H2,1H3,(H,9,10).
What are the key properties of 3-ethylsulfanylcarbonyl-1,2-oxazole-5-carboxylic acid?
3-ethylsulfanylcarbonyl-1,2-oxazole-5-carboxylic acid has a molecular weight of 201.20 g/mol, XLogP of 1.27, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylsulfanylcarbonyl-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 117215058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).