C14H17FN4 — CID 117224403
N'-[4-[(4-fluorophenyl)methyl]pyrimidin-2-yl]propane-1,3-diamine (PubChem CID 117224403) has the molecular formula C14H17FN4 and a molecular weight of 260.32 g/mol. Its IUPAC name is N'-[4-[(4-fluorophenyl)methyl]pyrimidin-2-yl]propane-1,3-diamine.
| Compound Name | N'-[4-[(4-fluorophenyl)methyl]pyrimidin-2-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 117224403 |
| Molecular Formula | C14H17FN4 |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | N'-[4-[(4-fluorophenyl)methyl]pyrimidin-2-yl]propane-1,3-diamine |
| SMILES | NCCCNc1nccc(Cc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C14H17FN4/c15-12-4-2-11(3-5-12)10-13-6-9-18-14(19-13)17-8-1-7-16/h2-6,9H,1,7-8,10,16H2,(H,17,18,19) |
| InChIKey | HTNXTAXJXAAHOY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|