About 2,4-dimethyl-2-(thiophen-2-ylmethyl)-1,3-oxazolidine;hydrochloride
2,4-dimethyl-2-(thiophen-2-ylmethyl)-1,3-oxazolidine;hydrochloride (PubChem CID 117228639) has the molecular formula C10H16ClNOS
and a molecular weight of 233.76 g/mol. Its IUPAC name is 2,4-dimethyl-2-(thiophen-2-ylmethyl)-1,3-oxazolidine;hydrochloride.
Molecular Properties
| Compound Name | 2,4-dimethyl-2-(thiophen-2-ylmethyl)-1,3-oxazolidine;hydrochloride |
| PubChem CID | 117228639 |
| Molecular Formula | C10H16ClNOS |
| Molecular Weight | 233.76 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 2,4-dimethyl-2-(thiophen-2-ylmethyl)-1,3-oxazolidine;hydrochloride |
| SMILES | CC1COC(C)(Cc2cccs2)N1.Cl |
| InChI | InChI=1S/C10H15NOS.ClH/c1-8-7-12-10(2,11-8)6-9-4-3-5-13-9;/h3-5,8,11H,6-7H2,1-2H3;1H |
| InChIKey | WUIRQKAJRREYAW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.76 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dimethyl-2-(thiophen-2-ylmethyl)-1,3-oxazolidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-2-(thiophen-2-ylmethyl)-1,3-oxazolidine;hydrochloride?
The IUPAC name of 2,4-dimethyl-2-(thiophen-2-ylmethyl)-1,3-oxazolidine;hydrochloride (CID 117228639) is 2,4-dimethyl-2-(thiophen-2-ylmethyl)-1,3-oxazolidine;hydrochloride.
What is the SMILES notation for 2,4-dimethyl-2-(thiophen-2-ylmethyl)-1,3-oxazolidine;hydrochloride?
The canonical SMILES for 2,4-dimethyl-2-(thiophen-2-ylmethyl)-1,3-oxazolidine;hydrochloride is CC1COC(C)(Cc2cccs2)N1.Cl.
What is the InChIKey of 2,4-dimethyl-2-(thiophen-2-ylmethyl)-1,3-oxazolidine;hydrochloride?
The InChIKey is WUIRQKAJRREYAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NOS.ClH/c1-8-7-12-10(2,11-8)6-9-4-3-5-13-9;/h3-5,8,11H,6-7H2,1-2H3;1H.
What are the key properties of 2,4-dimethyl-2-(thiophen-2-ylmethyl)-1,3-oxazolidine;hydrochloride?
2,4-dimethyl-2-(thiophen-2-ylmethyl)-1,3-oxazolidine;hydrochloride has a molecular weight of 233.76 g/mol, XLogP of 2.44, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-2-(thiophen-2-ylmethyl)-1,3-oxazolidine;hydrochloride is sourced from PubChem (CID 117228639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).