C12H17ClOS — CID 130604785
3-chloro-2,2-dimethyl-4-(2-thiophen-2-ylethyl)oxolane (PubChem CID 130604785) has the molecular formula C12H17ClOS and a molecular weight of 244.79 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-4-(2-thiophen-2-ylethyl)oxolane.
| Compound Name | 3-chloro-2,2-dimethyl-4-(2-thiophen-2-ylethyl)oxolane |
|---|---|
| PubChem CID | 130604785 |
| Molecular Formula | C12H17ClOS |
| Molecular Weight | 244.79 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 3-chloro-2,2-dimethyl-4-(2-thiophen-2-ylethyl)oxolane |
| SMILES | CC1(C)OCC(CCc2cccs2)C1Cl |
| InChI | InChI=1S/C12H17ClOS/c1-12(2)11(13)9(8-14-12)5-6-10-4-3-7-15-10/h3-4,7,9,11H,5-6,8H2,1-2H3 |
| InChIKey | AHTQEWZNMLZRHJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.79 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|