About 2-(1-ethylpiperidin-2-yl)-2,5-dimethyl-1,3-oxazolidine
2-(1-ethylpiperidin-2-yl)-2,5-dimethyl-1,3-oxazolidine (PubChem CID 117228861) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is 2-(1-ethylpiperidin-2-yl)-2,5-dimethyl-1,3-oxazolidine.
Molecular Properties
| Compound Name | 2-(1-ethylpiperidin-2-yl)-2,5-dimethyl-1,3-oxazolidine |
| PubChem CID | 117228861 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 2-(1-ethylpiperidin-2-yl)-2,5-dimethyl-1,3-oxazolidine |
| SMILES | CCN1CCCCC1C1(C)NCC(C)O1 |
| InChI | InChI=1S/C12H24N2O/c1-4-14-8-6-5-7-11(14)12(3)13-9-10(2)15-12/h10-11,13H,4-9H2,1-3H3 |
| InChIKey | QTTJYDHZBZKLCP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-ethylpiperidin-2-yl)-2,5-dimethyl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-ethylpiperidin-2-yl)-2,5-dimethyl-1,3-oxazolidine?
The IUPAC name of 2-(1-ethylpiperidin-2-yl)-2,5-dimethyl-1,3-oxazolidine (CID 117228861) is 2-(1-ethylpiperidin-2-yl)-2,5-dimethyl-1,3-oxazolidine.
What is the SMILES notation for 2-(1-ethylpiperidin-2-yl)-2,5-dimethyl-1,3-oxazolidine?
The canonical SMILES for 2-(1-ethylpiperidin-2-yl)-2,5-dimethyl-1,3-oxazolidine is CCN1CCCCC1C1(C)NCC(C)O1.
What is the InChIKey of 2-(1-ethylpiperidin-2-yl)-2,5-dimethyl-1,3-oxazolidine?
The InChIKey is QTTJYDHZBZKLCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O/c1-4-14-8-6-5-7-11(14)12(3)13-9-10(2)15-12/h10-11,13H,4-9H2,1-3H3.
What are the key properties of 2-(1-ethylpiperidin-2-yl)-2,5-dimethyl-1,3-oxazolidine?
2-(1-ethylpiperidin-2-yl)-2,5-dimethyl-1,3-oxazolidine has a molecular weight of 212.34 g/mol, XLogP of 1.59, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-ethylpiperidin-2-yl)-2,5-dimethyl-1,3-oxazolidine is sourced from PubChem (CID 117228861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).