C17H19F4N — CID 11723089
1-(2,3,5,6-tetrafluoro-4-hex-1-ynylphenyl)piperidine (PubChem CID 11723089) has the molecular formula C17H19F4N and a molecular weight of 313.34 g/mol. Its IUPAC name is 1-(2,3,5,6-tetrafluoro-4-hex-1-ynylphenyl)piperidine.
| Compound Name | 1-(2,3,5,6-tetrafluoro-4-hex-1-ynylphenyl)piperidine |
|---|---|
| PubChem CID | 11723089 |
| Molecular Formula | C17H19F4N |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 1-(2,3,5,6-tetrafluoro-4-hex-1-ynylphenyl)piperidine |
| SMILES | CCCCC#Cc1c(F)c(F)c(N2CCCCC2)c(F)c1F |
| InChI | InChI=1S/C17H19F4N/c1-2-3-4-6-9-12-13(18)15(20)17(16(21)14(12)19)22-10-7-5-8-11-22/h2-5,7-8,10-11H2,1H3 |
| InChIKey | ZZVFOPPMKMNZRF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|