C8H12ClN3OS — CID 117235314
1-(3-aminopropyl)-3-(5-chlorothiophen-2-yl)urea (PubChem CID 117235314) has the molecular formula C8H12ClN3OS and a molecular weight of 233.72 g/mol. Its IUPAC name is 1-(3-aminopropyl)-3-(5-chlorothiophen-2-yl)urea.
| Compound Name | 1-(3-aminopropyl)-3-(5-chlorothiophen-2-yl)urea |
|---|---|
| PubChem CID | 117235314 |
| Molecular Formula | C8H12ClN3OS |
| Molecular Weight | 233.72 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 1-(3-aminopropyl)-3-(5-chlorothiophen-2-yl)urea |
| SMILES | NCCCNC(=O)Nc1ccc(Cl)s1 |
| InChI | InChI=1S/C8H12ClN3OS/c9-6-2-3-7(14-6)12-8(13)11-5-1-4-10/h2-3H,1,4-5,10H2,(H2,11,12,13) |
| InChIKey | MJQKDJXAFZHGIJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.72 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|