C16H18N4S — CID 117236195
3-(5-methylthiophen-2-yl)-7-piperazin-1-ylimidazo[1,5-a]pyridine (PubChem CID 117236195) has the molecular formula C16H18N4S and a molecular weight of 298.42 g/mol. Its IUPAC name is 3-(5-methylthiophen-2-yl)-7-piperazin-1-ylimidazo[1,5-a]pyridine.
| Compound Name | 3-(5-methylthiophen-2-yl)-7-piperazin-1-ylimidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 117236195 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 3-(5-methylthiophen-2-yl)-7-piperazin-1-ylimidazo[1,5-a]pyridine |
| SMILES | Cc1ccc(-c2ncc3cc(N4CCNCC4)ccn23)s1 |
| InChI | InChI=1S/C16H18N4S/c1-12-2-3-15(21-12)16-18-11-14-10-13(4-7-20(14)16)19-8-5-17-6-9-19/h2-4,7,10-11,17H,5-6,8-9H2,1H3 |
| InChIKey | KSZGOPNQLNGYRK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |