C16H17N5 — CID 117236205
7-piperazin-1-yl-3-pyridin-2-ylimidazo[1,5-a]pyridine (PubChem CID 117236205) has the molecular formula C16H17N5 and a molecular weight of 279.35 g/mol. Its IUPAC name is 7-piperazin-1-yl-3-pyridin-2-ylimidazo[1,5-a]pyridine.
| Compound Name | 7-piperazin-1-yl-3-pyridin-2-ylimidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 117236205 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 7-piperazin-1-yl-3-pyridin-2-ylimidazo[1,5-a]pyridine |
| SMILES | c1ccc(-c2ncc3cc(N4CCNCC4)ccn23)nc1 |
| InChI | InChI=1S/C16H17N5/c1-2-5-18-15(3-1)16-19-12-14-11-13(4-8-21(14)16)20-9-6-17-7-10-20/h1-5,8,11-12,17H,6-7,9-10H2 |
| InChIKey | VCKNIQZFMCTYER-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |