About 2-(7-piperazin-1-ylimidazo[1,5-a]pyridin-3-yl)ethanol
2-(7-piperazin-1-ylimidazo[1,5-a]pyridin-3-yl)ethanol (PubChem CID 117236108) has the molecular formula C13H18N4O
and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-(7-piperazin-1-ylimidazo[1,5-a]pyridin-3-yl)ethanol.
Molecular Properties
| Compound Name | 2-(7-piperazin-1-ylimidazo[1,5-a]pyridin-3-yl)ethanol |
| PubChem CID | 117236108 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 2-(7-piperazin-1-ylimidazo[1,5-a]pyridin-3-yl)ethanol |
| SMILES | OCCc1ncc2cc(N3CCNCC3)ccn12 |
| InChI | InChI=1S/C13H18N4O/c18-8-2-13-15-10-12-9-11(1-5-17(12)13)16-6-3-14-4-7-16/h1,5,9-10,14,18H,2-4,6-8H2 |
| InChIKey | RYYYOTGKYCBYML-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 52.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(7-piperazin-1-ylimidazo[1,5-a]pyridin-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-piperazin-1-ylimidazo[1,5-a]pyridin-3-yl)ethanol?
The IUPAC name of 2-(7-piperazin-1-ylimidazo[1,5-a]pyridin-3-yl)ethanol (CID 117236108) is 2-(7-piperazin-1-ylimidazo[1,5-a]pyridin-3-yl)ethanol.
What is the SMILES notation for 2-(7-piperazin-1-ylimidazo[1,5-a]pyridin-3-yl)ethanol?
The canonical SMILES for 2-(7-piperazin-1-ylimidazo[1,5-a]pyridin-3-yl)ethanol is OCCc1ncc2cc(N3CCNCC3)ccn12.
What is the InChIKey of 2-(7-piperazin-1-ylimidazo[1,5-a]pyridin-3-yl)ethanol?
The InChIKey is RYYYOTGKYCBYML-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O/c18-8-2-13-15-10-12-9-11(1-5-17(12)13)16-6-3-14-4-7-16/h1,5,9-10,14,18H,2-4,6-8H2.
What are the key properties of 2-(7-piperazin-1-ylimidazo[1,5-a]pyridin-3-yl)ethanol?
2-(7-piperazin-1-ylimidazo[1,5-a]pyridin-3-yl)ethanol has a molecular weight of 246.31 g/mol, XLogP of 0.28, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-piperazin-1-ylimidazo[1,5-a]pyridin-3-yl)ethanol is sourced from PubChem (CID 117236108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).