C13H18N4O — CID 117236108
2-(7-piperazin-1-ylimidazo[1,5-a]pyridin-3-yl)ethanol (PubChem CID 117236108) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-(7-piperazin-1-ylimidazo[1,5-a]pyridin-3-yl)ethanol.
| Compound Name | 2-(7-piperazin-1-ylimidazo[1,5-a]pyridin-3-yl)ethanol |
|---|---|
| PubChem CID | 117236108 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 2-(7-piperazin-1-ylimidazo[1,5-a]pyridin-3-yl)ethanol |
| SMILES | OCCc1ncc2cc(N3CCNCC3)ccn12 |
| InChI | InChI=1S/C13H18N4O/c18-8-2-13-15-10-12-9-11(1-5-17(12)13)16-6-3-14-4-7-16/h1,5,9-10,14,18H,2-4,6-8H2 |
| InChIKey | RYYYOTGKYCBYML-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 52.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |