C12H21NO5S — CID 117238182
methyl 2-(1,1-dioxothiolan-3-yl)-3-morpholin-4-ylpropanoate (PubChem CID 117238182) has the molecular formula C12H21NO5S and a molecular weight of 291.37 g/mol. Its IUPAC name is methyl 2-(1,1-dioxothiolan-3-yl)-3-morpholin-4-ylpropanoate.
| Compound Name | methyl 2-(1,1-dioxothiolan-3-yl)-3-morpholin-4-ylpropanoate |
|---|---|
| PubChem CID | 117238182 |
| Molecular Formula | C12H21NO5S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | methyl 2-(1,1-dioxothiolan-3-yl)-3-morpholin-4-ylpropanoate |
| SMILES | COC(=O)C(CN1CCOCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H21NO5S/c1-17-12(14)11(8-13-3-5-18-6-4-13)10-2-7-19(15,16)9-10/h10-11H,2-9H2,1H3 |
| InChIKey | NVHPXQUMTMCKLF-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |