C15H27NO4S — CID 117239589
methyl 3-(azepan-1-yl)-2-(1,1-dioxothian-4-yl)propanoate (PubChem CID 117239589) has the molecular formula C15H27NO4S and a molecular weight of 317.45 g/mol. Its IUPAC name is methyl 3-(azepan-1-yl)-2-(1,1-dioxothian-4-yl)propanoate.
| Compound Name | methyl 3-(azepan-1-yl)-2-(1,1-dioxothian-4-yl)propanoate |
|---|---|
| PubChem CID | 117239589 |
| Molecular Formula | C15H27NO4S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | methyl 3-(azepan-1-yl)-2-(1,1-dioxothian-4-yl)propanoate |
| SMILES | COC(=O)C(CN1CCCCCC1)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C15H27NO4S/c1-20-15(17)14(12-16-8-4-2-3-5-9-16)13-6-10-21(18,19)11-7-13/h13-14H,2-12H2,1H3 |
| InChIKey | CWEVZKANCICUPD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |