C13H23NO5S — CID 117239606
methyl 2-(1,1-dioxothian-4-yl)-3-morpholin-4-ylpropanoate (PubChem CID 117239606) has the molecular formula C13H23NO5S and a molecular weight of 305.40 g/mol. Its IUPAC name is methyl 2-(1,1-dioxothian-4-yl)-3-morpholin-4-ylpropanoate.
| Compound Name | methyl 2-(1,1-dioxothian-4-yl)-3-morpholin-4-ylpropanoate |
|---|---|
| PubChem CID | 117239606 |
| Molecular Formula | C13H23NO5S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | methyl 2-(1,1-dioxothian-4-yl)-3-morpholin-4-ylpropanoate |
| SMILES | COC(=O)C(CN1CCOCC1)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H23NO5S/c1-18-13(15)12(10-14-4-6-19-7-5-14)11-2-8-20(16,17)9-3-11/h11-12H,2-10H2,1H3 |
| InChIKey | MGCMUDUZKZGKBK-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |